C18H25Cl2N7O — CID 119834571
N-[3-(benzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride (PubChem CID 119834571) has the molecular formula C18H25Cl2N7O and a molecular weight of 426.35 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119834571 |
| Molecular Formula | C18H25Cl2N7O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-1-piperidin-4-yltriazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCn1cnc2ccccc21)c1cn(C2CCNCC2)nn1 |
| InChI | InChI=1S/C18H23N7O.2ClH/c26-18(16-12-25(23-22-16)14-6-9-19-10-7-14)20-8-3-11-24-13-21-15-4-1-2-5-17(15)24;;/h1-2,4-5,12-14,19H,3,6-11H2,(H,20,26);2*1H |
| InChIKey | VTDJWZWXLQNDJK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|