C17H26ClN3O4S — CID 119699511
N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]morpholine-2-carboxamide;hydrochloride (PubChem CID 119699511) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119699511 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]morpholine-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(NC(=O)C3CNCCO3)CC2)cc1.Cl |
| InChI | InChI=1S/C17H25N3O4S.ClH/c1-13-2-4-15(5-3-13)25(22,23)20-9-6-14(7-10-20)19-17(21)16-12-18-8-11-24-16;/h2-5,14,16,18H,6-12H2,1H3,(H,19,21);1H |
| InChIKey | PYOJJYROXDQBQD-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |