C19H23Cl2N3O3 — CID 119703658
4-amino-5-chloro-2-methoxy-N-[4-(3-methylbutanoylamino)phenyl]benzamide;hydrochloride (PubChem CID 119703658) has the molecular formula C19H23Cl2N3O3 and a molecular weight of 412.32 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[4-(3-methylbutanoylamino)phenyl]benzamide;hydrochloride.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[4-(3-methylbutanoylamino)phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119703658 |
| Molecular Formula | C19H23Cl2N3O3 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[4-(3-methylbutanoylamino)phenyl]benzamide;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)Nc1ccc(NC(=O)CC(C)C)cc1.Cl |
| InChI | InChI=1S/C19H22ClN3O3.ClH/c1-11(2)8-18(24)22-12-4-6-13(7-5-12)23-19(25)14-9-15(20)16(21)10-17(14)26-3;/h4-7,9-11H,8,21H2,1-3H3,(H,22,24)(H,23,25);1H |
| InChIKey | RHCGIJJAHOHPDW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|