C19H22Cl2N2O5 — CID 119784217
methyl 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]phenoxy]butanoate;hydrochloride (PubChem CID 119784217) has the molecular formula C19H22Cl2N2O5 and a molecular weight of 429.30 g/mol. Its IUPAC name is methyl 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]phenoxy]butanoate;hydrochloride.
| Compound Name | methyl 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]phenoxy]butanoate;hydrochloride |
|---|---|
| PubChem CID | 119784217 |
| Molecular Formula | C19H22Cl2N2O5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl 4-[4-[(4-amino-5-chloro-2-methoxybenzoyl)amino]phenoxy]butanoate;hydrochloride |
| SMILES | COC(=O)CCCOc1ccc(NC(=O)c2cc(Cl)c(N)cc2OC)cc1.Cl |
| InChI | InChI=1S/C19H21ClN2O5.ClH/c1-25-17-11-16(21)15(20)10-14(17)19(24)22-12-5-7-13(8-6-12)27-9-3-4-18(23)26-2;/h5-8,10-11H,3-4,9,21H2,1-2H3,(H,22,24);1H |
| InChIKey | SHRZKMWVDNFGKJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|