C12H16ClN3O4 — CID 119709902
2-(2-methoxyethylamino)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide;hydrochloride (PubChem CID 119709902) has the molecular formula C12H16ClN3O4 and a molecular weight of 301.73 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119709902 |
| Molecular Formula | C12H16ClN3O4 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc2oc(=O)[nH]c2c1.Cl |
| InChI | InChI=1S/C12H15N3O4.ClH/c1-18-5-4-13-7-11(16)14-8-2-3-10-9(6-8)15-12(17)19-10;/h2-3,6,13H,4-5,7H2,1H3,(H,14,16)(H,15,17);1H |
| InChIKey | VRKQGCGUSLDHMU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|