About [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol
[5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol (PubChem CID 11971224) has the molecular formula C7H14O5
and a molecular weight of 178.18 g/mol. Its IUPAC name is [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol |
| PubChem CID | 11971224 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol |
| SMILES | OCOCC1(CO)COCOC1 |
| InChI | InChI=1S/C7H14O5/c8-1-7(2-10-5-9)3-11-6-12-4-7/h8-9H,1-6H2 |
| InChIKey | DKNIFLGCIMSZGQ-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol?
The IUPAC name of [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol (CID 11971224) is [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol?
The canonical SMILES for [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol is OCOCC1(CO)COCOC1.
What is the InChIKey of [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol?
The InChIKey is DKNIFLGCIMSZGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O5/c8-1-7(2-10-5-9)3-11-6-12-4-7/h8-9H,1-6H2.
What are the key properties of [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol?
[5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol has a molecular weight of 178.18 g/mol, XLogP of -1.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethoxymethyl)-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 11971224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).