C10H15ClN2O2S — CID 119716331
2-(azetidin-3-yloxy)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride (PubChem CID 119716331) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-(azetidin-3-yloxy)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride.
| Compound Name | 2-(azetidin-3-yloxy)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119716331 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(azetidin-3-yloxy)-N-(thiophen-3-ylmethyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(COC1CNC1)NCc1ccsc1 |
| InChI | InChI=1S/C10H14N2O2S.ClH/c13-10(6-14-9-4-11-5-9)12-3-8-1-2-15-7-8;/h1-2,7,9,11H,3-6H2,(H,12,13);1H |
| InChIKey | GBBWKBLGOJBOQZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |