C19H22N2O4 — CID 11971830
1-[[2-(1-benzofuran-2-yl)-4-(propoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole (PubChem CID 11971830) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[[2-(1-benzofuran-2-yl)-4-(propoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole.
| Compound Name | 1-[[2-(1-benzofuran-2-yl)-4-(propoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
|---|---|
| PubChem CID | 11971830 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[[2-(1-benzofuran-2-yl)-4-(propoxymethyl)-1,3-dioxolan-2-yl]methyl]imidazole |
| SMILES | CCCOCC1COC(Cn2ccnc2)(c2cc3ccccc3o2)O1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-9-22-11-16-12-23-19(25-16,13-21-8-7-20-14-21)18-10-15-5-3-4-6-17(15)24-18/h3-8,10,14,16H,2,9,11-13H2,1H3 |
| InChIKey | GXGMSNINQJIYOW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|