C14H20ClFN2O — CID 119718833
1-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-4-(methylamino)butan-1-one;hydrochloride (PubChem CID 119718833) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 1-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-4-(methylamino)butan-1-one;hydrochloride.
| Compound Name | 1-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-4-(methylamino)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119718833 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(6-fluoro-3,4-dihydro-2H-quinolin-1-yl)-4-(methylamino)butan-1-one;hydrochloride |
| SMILES | CNCCCC(=O)N1CCCc2cc(F)ccc21.Cl |
| InChI | InChI=1S/C14H19FN2O.ClH/c1-16-8-2-5-14(18)17-9-3-4-11-10-12(15)6-7-13(11)17;/h6-7,10,16H,2-5,8-9H2,1H3;1H |
| InChIKey | WOJZCQRWFZQYIK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|