C16H23N3O2 — CID 60598985
[5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-oxopentyl]urea (PubChem CID 60598985) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is [5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-oxopentyl]urea.
| Compound Name | [5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-oxopentyl]urea |
|---|---|
| PubChem CID | 60598985 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | [5-(6-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-oxopentyl]urea |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)CCCCNC(N)=O |
| InChI | InChI=1S/C16H23N3O2/c1-12-7-8-14-13(11-12)5-4-10-19(14)15(20)6-2-3-9-18-16(17)21/h7-8,11H,2-6,9-10H2,1H3,(H3,17,18,21) |
| InChIKey | VUFCYRPSIZMIJE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|