methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate

C15H19NO3 — CID 75485040

IUPACmethyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate
SMILESCOC(=O)CCCC(=O)N1CCc2cc(C)ccc21
InChIInChI=1S/C15H19NO3/c1-11-6-7-13-12(10-11)8-9-16(13)14(17)4-3-5-15(18)19-2/h6-7,10H,3-5,8-9H2,1-2H3
InChIKeyJFBKQTUAOXWXAJ-UHFFFAOYSA-N
MW261.32 g/mol
LogP2.23
Rot. Bonds4

About methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate

methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate (PubChem CID 75485040) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate.

Molecular Properties

Compound Namemethyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate
PubChem CID75485040
Molecular FormulaC15H19NO3
Molecular Weight261.32 g/mol
Exact Mass261.14
IUPAC Namemethyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate
SMILESCOC(=O)CCCC(=O)N1CCc2cc(C)ccc21
InChIInChI=1S/C15H19NO3/c1-11-6-7-13-12(10-11)8-9-16(13)14(17)4-3-5-15(18)19-2/h6-7,10H,3-5,8-9H2,1-2H3
InChIKeyJFBKQTUAOXWXAJ-UHFFFAOYSA-N
XLogP2.23
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.32
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate?
The IUPAC name of methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate (CID 75485040) is methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate.
What is the SMILES notation for methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate?
The canonical SMILES for methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate is COC(=O)CCCC(=O)N1CCc2cc(C)ccc21.
What is the InChIKey of methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate?
The InChIKey is JFBKQTUAOXWXAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO3/c1-11-6-7-13-12(10-11)8-9-16(13)14(17)4-3-5-15(18)19-2/h6-7,10H,3-5,8-9H2,1-2H3.
What are the key properties of methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate?
methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate has a molecular weight of 261.32 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(5-methyl-2,3-dihydroindol-1-yl)-5-oxopentanoate is sourced from PubChem (CID 75485040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).