C18H23ClN2O4 — CID 119719526
2-(4-aminophenyl)-N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride (PubChem CID 119719526) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119719526 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-(4-aminophenyl)-N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]acetamide;hydrochloride |
| SMILES | COc1cc(OC)cc(C(O)CNC(=O)Cc2ccc(N)cc2)c1.Cl |
| InChI | InChI=1S/C18H22N2O4.ClH/c1-23-15-8-13(9-16(10-15)24-2)17(21)11-20-18(22)7-12-3-5-14(19)6-4-12;/h3-6,8-10,17,21H,7,11,19H2,1-2H3,(H,20,22);1H |
| InChIKey | ZVDVZHUIHCZYNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|