C19H23Cl2N3O2 — CID 119738309
4-[(3-aminobenzoyl)amino]-2-chloro-N-(2-methylbutan-2-yl)benzamide;hydrochloride (PubChem CID 119738309) has the molecular formula C19H23Cl2N3O2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 4-[(3-aminobenzoyl)amino]-2-chloro-N-(2-methylbutan-2-yl)benzamide;hydrochloride.
| Compound Name | 4-[(3-aminobenzoyl)amino]-2-chloro-N-(2-methylbutan-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119738309 |
| Molecular Formula | C19H23Cl2N3O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[(3-aminobenzoyl)amino]-2-chloro-N-(2-methylbutan-2-yl)benzamide;hydrochloride |
| SMILES | CCC(C)(C)NC(=O)c1ccc(NC(=O)c2cccc(N)c2)cc1Cl.Cl |
| InChI | InChI=1S/C19H22ClN3O2.ClH/c1-4-19(2,3)23-18(25)15-9-8-14(11-16(15)20)22-17(24)12-6-5-7-13(21)10-12;/h5-11H,4,21H2,1-3H3,(H,22,24)(H,23,25);1H |
| InChIKey | ZNLBCJXDZFSWIQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|