C16H23ClN4O3 — CID 60539304
2-chloro-N-(2-methylbutan-2-yl)-4-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide (PubChem CID 60539304) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 60539304 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc(NCC(=O)NC(=O)NC)cc1Cl |
| InChI | InChI=1S/C16H23ClN4O3/c1-5-16(2,3)21-14(23)11-7-6-10(8-12(11)17)19-9-13(22)20-15(24)18-4/h6-8,19H,5,9H2,1-4H3,(H,21,23)(H2,18,20,22,24) |
| InChIKey | NOCMWAGOISMTLH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |