C16H23ClN4O5 — CID 55917738
2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]benzamide (PubChem CID 55917738) has the molecular formula C16H23ClN4O5 and a molecular weight of 386.84 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 55917738 |
| Molecular Formula | C16H23ClN4O5 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]benzamide |
| SMILES | COCCNC(=O)NC(=O)CNc1ccc(C(=O)NCCOC)c(Cl)c1 |
| InChI | InChI=1S/C16H23ClN4O5/c1-25-7-5-18-15(23)12-4-3-11(9-13(12)17)20-10-14(22)21-16(24)19-6-8-26-2/h3-4,9,20H,5-8,10H2,1-2H3,(H,18,23)(H2,19,21,22,24) |
| InChIKey | YAJMKRMFRLWIRC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|