C19H23ClN4O4S — CID 55919274
2-chloro-N-(2-methoxyethyl)-4-[[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl]amino]benzamide (PubChem CID 55919274) has the molecular formula C19H23ClN4O4S and a molecular weight of 438.94 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-4-[[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 55919274 |
| Molecular Formula | C19H23ClN4O4S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-4-[[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl]amino]benzamide |
| SMILES | COCCNC(=O)c1ccc(NCC(=O)NC(=O)NCCc2cccs2)cc1Cl |
| InChI | InChI=1S/C19H23ClN4O4S/c1-28-9-8-21-18(26)15-5-4-13(11-16(15)20)23-12-17(25)24-19(27)22-7-6-14-3-2-10-29-14/h2-5,10-11,23H,6-9,12H2,1H3,(H,21,26)(H2,22,24,25,27) |
| InChIKey | CZMXNGMGNVUHOW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|