C15H15F2N3O2S — CID 35824098
2-(3,5-difluoroanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 35824098) has the molecular formula C15H15F2N3O2S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-(3,5-difluoroanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(3,5-difluoroanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 35824098 |
| Molecular Formula | C15H15F2N3O2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(3,5-difluoroanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | O=C(CNc1cc(F)cc(F)c1)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H15F2N3O2S/c16-10-6-11(17)8-12(7-10)19-9-14(21)20-15(22)18-4-3-13-2-1-5-23-13/h1-2,5-8,19H,3-4,9H2,(H2,18,20,21,22) |
| InChIKey | ZNIACAGZJHWELF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |