C16H16F3N3O3S — CID 30644950
N-(2-thiophen-2-ylethylcarbamoyl)-2-[2-(trifluoromethoxy)anilino]acetamide (PubChem CID 30644950) has the molecular formula C16H16F3N3O3S and a molecular weight of 387.38 g/mol. Its IUPAC name is N-(2-thiophen-2-ylethylcarbamoyl)-2-[2-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-(2-thiophen-2-ylethylcarbamoyl)-2-[2-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 30644950 |
| Molecular Formula | C16H16F3N3O3S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(2-thiophen-2-ylethylcarbamoyl)-2-[2-(trifluoromethoxy)anilino]acetamide |
| SMILES | O=C(CNc1ccccc1OC(F)(F)F)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C16H16F3N3O3S/c17-16(18,19)25-13-6-2-1-5-12(13)21-10-14(23)22-15(24)20-8-7-11-4-3-9-26-11/h1-6,9,21H,7-8,10H2,(H2,20,22,23,24) |
| InChIKey | CWDXKNBKQRKKIP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |