C17H21N3O2S — CID 51202795
2-(2,3-dimethylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 51202795) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(2,3-dimethylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 51202795 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2,3-dimethylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | Cc1cccc(NCC(=O)NC(=O)NCCc2cccs2)c1C |
| InChI | InChI=1S/C17H21N3O2S/c1-12-5-3-7-15(13(12)2)19-11-16(21)20-17(22)18-9-8-14-6-4-10-23-14/h3-7,10,19H,8-9,11H2,1-2H3,(H2,18,20,21,22) |
| InChIKey | FYYUYJHNERFACY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |