C21H28N4O4S2 — CID 37479540
2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 37479540) has the molecular formula C21H28N4O4S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 37479540 |
| Molecular Formula | C21H28N4O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NCC(=O)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C21H28N4O4S2/c1-16-7-8-18(31(28,29)25-11-3-2-4-12-25)14-19(16)23-15-20(26)24-21(27)22-10-9-17-6-5-13-30-17/h5-8,13-14,23H,2-4,9-12,15H2,1H3,(H2,22,24,26,27) |
| InChIKey | GRMFSAQFMSZOIV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |