C20H33N5O4S — CID 55410668
N-(butylcarbamoyl)-2-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]acetamide (PubChem CID 55410668) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]acetamide |
|---|---|
| PubChem CID | 55410668 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-(butylcarbamoyl)-2-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]acetamide |
| SMILES | CCCCNC(=O)NC(=O)CNc1cc(S(=O)(=O)N2CCCCC2)ccc1N(C)C |
| InChI | InChI=1S/C20H33N5O4S/c1-4-5-11-21-20(27)23-19(26)15-22-17-14-16(9-10-18(17)24(2)3)30(28,29)25-12-7-6-8-13-25/h9-10,14,22H,4-8,11-13,15H2,1-3H3,(H2,21,23,26,27) |
| InChIKey | VPHCIGTWPBWXHR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|