C23H30N4O5S — CID 24510809
N-(ethylcarbamoyl)-2-[2-(3-methylphenoxy)-5-piperidin-1-ylsulfonylanilino]acetamide (PubChem CID 24510809) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[2-(3-methylphenoxy)-5-piperidin-1-ylsulfonylanilino]acetamide.
| Compound Name | N-(ethylcarbamoyl)-2-[2-(3-methylphenoxy)-5-piperidin-1-ylsulfonylanilino]acetamide |
|---|---|
| PubChem CID | 24510809 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[2-(3-methylphenoxy)-5-piperidin-1-ylsulfonylanilino]acetamide |
| SMILES | CCNC(=O)NC(=O)CNc1cc(S(=O)(=O)N2CCCCC2)ccc1Oc1cccc(C)c1 |
| InChI | InChI=1S/C23H30N4O5S/c1-3-24-23(29)26-22(28)16-25-20-15-19(33(30,31)27-12-5-4-6-13-27)10-11-21(20)32-18-9-7-8-17(2)14-18/h7-11,14-15,25H,3-6,12-13,16H2,1-2H3,(H2,24,26,28,29) |
| InChIKey | KKMUNPHETUSWLQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |