C17H19N3O3S — CID 78807187
2-(4-acetylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 78807187) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(4-acetylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(4-acetylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 78807187 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-(4-acetylanilino)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | CC(=O)c1ccc(NCC(=O)NC(=O)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12(21)13-4-6-14(7-5-13)19-11-16(22)20-17(23)18-9-8-15-3-2-10-24-15/h2-7,10,19H,8-9,11H2,1H3,(H2,18,20,22,23) |
| InChIKey | NSOASLWQUHIPCK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |