C17H15ClF3N3O3 — CID 55917443
2-chloro-N-methyl-4-[[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]amino]benzamide (PubChem CID 55917443) has the molecular formula C17H15ClF3N3O3 and a molecular weight of 401.77 g/mol. Its IUPAC name is 2-chloro-N-methyl-4-[[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-methyl-4-[[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 55917443 |
| Molecular Formula | C17H15ClF3N3O3 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-chloro-N-methyl-4-[[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]amino]benzamide |
| SMILES | CNC(=O)c1ccc(NCC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C17H15ClF3N3O3/c1-22-16(26)13-7-4-11(8-14(13)18)23-9-15(25)24-10-2-5-12(6-3-10)27-17(19,20)21/h2-8,23H,9H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | BFRCXYPCBGWFQK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |