C18H18ClN3O3 — CID 52704961
4-[[2-(3-acetylanilino)-2-oxoethyl]amino]-2-chloro-N-methylbenzamide (PubChem CID 52704961) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is 4-[[2-(3-acetylanilino)-2-oxoethyl]amino]-2-chloro-N-methylbenzamide.
| Compound Name | 4-[[2-(3-acetylanilino)-2-oxoethyl]amino]-2-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 52704961 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 4-[[2-(3-acetylanilino)-2-oxoethyl]amino]-2-chloro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NCC(=O)Nc2cccc(C(C)=O)c2)cc1Cl |
| InChI | InChI=1S/C18H18ClN3O3/c1-11(23)12-4-3-5-14(8-12)22-17(24)10-21-13-6-7-15(16(19)9-13)18(25)20-2/h3-9,21H,10H2,1-2H3,(H,20,25)(H,22,24) |
| InChIKey | GDFHSZMGKQYCJJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |