C25H33ClN4O2 — CID 60539115
2-chloro-N-(2-methylbutan-2-yl)-4-[[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]amino]benzamide (PubChem CID 60539115) has the molecular formula C25H33ClN4O2 and a molecular weight of 457.02 g/mol. Its IUPAC name is 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]amino]benzamide.
| Compound Name | 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 60539115 |
| Molecular Formula | C25H33ClN4O2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-chloro-N-(2-methylbutan-2-yl)-4-[[2-oxo-2-(4-piperidin-1-ylanilino)ethyl]amino]benzamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc(NCC(=O)Nc2ccc(N3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C25H33ClN4O2/c1-4-25(2,3)29-24(32)21-13-10-19(16-22(21)26)27-17-23(31)28-18-8-11-20(12-9-18)30-14-6-5-7-15-30/h8-13,16,27H,4-7,14-15,17H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | YBOAFDZGWIWGGZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|