C34H34O4 — CID 11974045
dimethyl 1,4-dibutylpentacene-2,3-dicarboxylate (PubChem CID 11974045) has the molecular formula C34H34O4 and a molecular weight of 506.64 g/mol. Its IUPAC name is dimethyl 1,4-dibutylpentacene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4-dibutylpentacene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11974045 |
| Molecular Formula | C34H34O4 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | dimethyl 1,4-dibutylpentacene-2,3-dicarboxylate |
| SMILES | CCCCc1c(C(=O)OC)c(C(=O)OC)c(CCCC)c2cc3cc4cc5ccccc5cc4cc3cc12 |
| InChI | InChI=1S/C34H34O4/c1-5-7-13-27-29-19-25-17-23-15-21-11-9-10-12-22(21)16-24(23)18-26(25)20-30(29)28(14-8-6-2)32(34(36)38-4)31(27)33(35)37-3/h9-12,15-20H,5-8,13-14H2,1-4H3 |
| InChIKey | GZQNTKSWVOGVIY-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|