C30H28F3N5O8 — CID 11974138
methyl 8-[[4-(2-methylpropoxy)-8-nitroquinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate (PubChem CID 11974138) has the molecular formula C30H28F3N5O8 and a molecular weight of 643.58 g/mol. Its IUPAC name is methyl 8-[[4-(2-methylpropoxy)-8-nitroquinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate.
| Compound Name | methyl 8-[[4-(2-methylpropoxy)-8-nitroquinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11974138 |
| Molecular Formula | C30H28F3N5O8 |
| Molecular Weight | 643.58 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | methyl 8-[[4-(2-methylpropoxy)-8-nitroquinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OCCCNC(=O)C(F)(F)F)c2cccc(NC(=O)c3cc(OCC(C)C)c4cccc([N+](=O)[O-])c4n3)c2n1 |
| InChI | InChI=1S/C30H28F3N5O8/c1-16(2)15-46-24-13-20(35-26-18(24)8-5-10-22(26)38(42)43)27(39)37-19-9-4-7-17-23(14-21(28(40)44-3)36-25(17)19)45-12-6-11-34-29(41)30(31,32)33/h4-5,7-10,13-14,16H,6,11-12,15H2,1-3H3,(H,34,41)(H,37,39) |
| InChIKey | IHDXLKMVCUVCSQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|