C21H16F5N3O4 — CID 71740382
4-(2-methylpropoxy)-8-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide (PubChem CID 71740382) has the molecular formula C21H16F5N3O4 and a molecular weight of 469.37 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-8-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide.
| Compound Name | 4-(2-methylpropoxy)-8-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71740382 |
| Molecular Formula | C21H16F5N3O4 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 4-(2-methylpropoxy)-8-nitro-N-[(2,3,4,5,6-pentafluorophenyl)methyl]quinoline-2-carboxamide |
| SMILES | CC(C)COc1cc(C(=O)NCc2c(F)c(F)c(F)c(F)c2F)nc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C21H16F5N3O4/c1-9(2)8-33-14-6-12(28-20-10(14)4-3-5-13(20)29(31)32)21(30)27-7-11-15(22)17(24)19(26)18(25)16(11)23/h3-6,9H,7-8H2,1-2H3,(H,27,30) |
| InChIKey | MLAHPPQAXYRNME-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|