C30H30F3N5O6 — CID 11974139
methyl 8-[[8-amino-4-(2-methylpropoxy)quinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate (PubChem CID 11974139) has the molecular formula C30H30F3N5O6 and a molecular weight of 613.59 g/mol. Its IUPAC name is methyl 8-[[8-amino-4-(2-methylpropoxy)quinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate.
| Compound Name | methyl 8-[[8-amino-4-(2-methylpropoxy)quinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11974139 |
| Molecular Formula | C30H30F3N5O6 |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | methyl 8-[[8-amino-4-(2-methylpropoxy)quinoline-2-carbonyl]amino]-4-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OCCCNC(=O)C(F)(F)F)c2cccc(NC(=O)c3cc(OCC(C)C)c4cccc(N)c4n3)c2n1 |
| InChI | InChI=1S/C30H30F3N5O6/c1-16(2)15-44-24-13-21(36-25-17(24)7-4-9-19(25)34)27(39)38-20-10-5-8-18-23(14-22(28(40)42-3)37-26(18)20)43-12-6-11-35-29(41)30(31,32)33/h4-5,7-10,13-14,16H,6,11-12,15,34H2,1-3H3,(H,35,41)(H,38,39) |
| InChIKey | ASIWAZOODNASBL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|