C17H20ClN3O4 — CID 119743183
N-[4-(furan-2-carbonylamino)-3-methylphenyl]morpholine-2-carboxamide;hydrochloride (PubChem CID 119743183) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is N-[4-(furan-2-carbonylamino)-3-methylphenyl]morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(furan-2-carbonylamino)-3-methylphenyl]morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119743183 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | N-[4-(furan-2-carbonylamino)-3-methylphenyl]morpholine-2-carboxamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)C2CNCCO2)ccc1NC(=O)c1ccco1.Cl |
| InChI | InChI=1S/C17H19N3O4.ClH/c1-11-9-12(19-17(22)15-10-18-6-8-24-15)4-5-13(11)20-16(21)14-3-2-7-23-14;/h2-5,7,9,15,18H,6,8,10H2,1H3,(H,19,22)(H,20,21);1H |
| InChIKey | GTTSDABDFPYATN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |