C16H16ClN3O4 — CID 119743095
N-[3-chloro-4-(furan-2-carbonylamino)phenyl]morpholine-2-carboxamide (PubChem CID 119743095) has the molecular formula C16H16ClN3O4 and a molecular weight of 349.77 g/mol. Its IUPAC name is N-[3-chloro-4-(furan-2-carbonylamino)phenyl]morpholine-2-carboxamide.
| Compound Name | N-[3-chloro-4-(furan-2-carbonylamino)phenyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119743095 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | N-[3-chloro-4-(furan-2-carbonylamino)phenyl]morpholine-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C2CNCCO2)cc1Cl)c1ccco1 |
| InChI | InChI=1S/C16H16ClN3O4/c17-11-8-10(19-16(22)14-9-18-5-7-24-14)3-4-12(11)20-15(21)13-2-1-6-23-13/h1-4,6,8,14,18H,5,7,9H2,(H,19,22)(H,20,21) |
| InChIKey | XZHUGYFUMQVPOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |