C22H42O3Si — CID 11974402
(3S,4S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxyhept-5-enyl]-3-hexyloxetan-2-one (PubChem CID 11974402) has the molecular formula C22H42O3Si and a molecular weight of 382.66 g/mol. Its IUPAC name is (3S,4S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxyhept-5-enyl]-3-hexyloxetan-2-one.
| Compound Name | (3S,4S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxyhept-5-enyl]-3-hexyloxetan-2-one |
|---|---|
| PubChem CID | 11974402 |
| Molecular Formula | C22H42O3Si |
| Molecular Weight | 382.66 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (3S,4S)-4-[(E,2R)-2-[tert-butyl(dimethyl)silyl]oxyhept-5-enyl]-3-hexyloxetan-2-one |
| SMILES | C/C=C/CC[C@H](C[C@@H]1OC(=O)[C@H]1CCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O3Si/c1-8-10-12-14-16-19-20(24-21(19)23)17-18(15-13-11-9-2)25-26(6,7)22(3,4)5/h9,11,18-20H,8,10,12-17H2,1-7H3/b11-9+/t18-,19+,20+/m1/s1 |
| InChIKey | RYSHSUVMYDRMQS-GEBLETALSA-N |
| XLogP | 6.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.66 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|