C18H23ClN2O2 — CID 119747137
(4-amino-5-chloro-2-methoxyphenyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone (PubChem CID 119747137) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone |
|---|---|
| PubChem CID | 119747137 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-(4-azatricyclo[4.3.1.13,8]undecan-4-yl)methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CC2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H23ClN2O2/c1-23-17-8-16(20)15(19)7-14(17)18(22)21-9-12-3-10-2-11(4-12)6-13(21)5-10/h7-8,10-13H,2-6,9,20H2,1H3 |
| InChIKey | GGRDSFWSHQUIJW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|