C21H22ClFN2O2 — CID 98067118
(4-amino-5-chloro-2-methoxyphenyl)-[(1S,5S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]methanone (PubChem CID 98067118) has the molecular formula C21H22ClFN2O2 and a molecular weight of 388.87 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-[(1S,5S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]methanone.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-[(1S,5S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
|---|---|
| PubChem CID | 98067118 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-[(1S,5S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]methanone |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1[C@H]2CC[C@H]1CC(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C21H22ClFN2O2/c1-27-20-11-19(24)18(22)10-17(20)21(26)25-15-6-7-16(25)9-13(8-15)12-2-4-14(23)5-3-12/h2-5,10-11,13,15-16H,6-9,24H2,1H3/t15-,16-/m0/s1 |
| InChIKey | KRDILUFFWNMZAZ-HOTGVXAUSA-N |
| XLogP | 4.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|