About 4-methoxybenzene-1,3-diamine;dihydrochloride
4-methoxybenzene-1,3-diamine;dihydrochloride (PubChem CID 11975) has the molecular formula C7H12Cl2N2O
and a molecular weight of 211.09 g/mol. Its IUPAC name is 4-methoxybenzene-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 4-methoxybenzene-1,3-diamine;dihydrochloride |
| PubChem CID | 11975 |
| Molecular Formula | C7H12Cl2N2O |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4-methoxybenzene-1,3-diamine;dihydrochloride |
| SMILES | COc1ccc(N)cc1N.Cl.Cl |
| InChI | InChI=1S/C7H10N2O.2ClH/c1-10-7-3-2-5(8)4-6(7)9;;/h2-4H,8-9H2,1H3;2*1H |
| InChIKey | FNGHHDCBSVSOOI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybenzene-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzene-1,3-diamine;dihydrochloride?
The IUPAC name of 4-methoxybenzene-1,3-diamine;dihydrochloride (CID 11975) is 4-methoxybenzene-1,3-diamine;dihydrochloride.
What is the SMILES notation for 4-methoxybenzene-1,3-diamine;dihydrochloride?
The canonical SMILES for 4-methoxybenzene-1,3-diamine;dihydrochloride is COc1ccc(N)cc1N.Cl.Cl.
What is the InChIKey of 4-methoxybenzene-1,3-diamine;dihydrochloride?
The InChIKey is FNGHHDCBSVSOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.2ClH/c1-10-7-3-2-5(8)4-6(7)9;;/h2-4H,8-9H2,1H3;2*1H.
What are the key properties of 4-methoxybenzene-1,3-diamine;dihydrochloride?
4-methoxybenzene-1,3-diamine;dihydrochloride has a molecular weight of 211.09 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzene-1,3-diamine;dihydrochloride is sourced from PubChem (CID 11975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).