C23H30N2O3 — CID 119765075
3-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]cyclohexane-1-carboxamide (PubChem CID 119765075) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119765075 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3-amino-N-[2-(3,4-dimethoxyphenyl)-1-phenylethyl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(CC(NC(=O)C2CCCC(N)C2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H30N2O3/c1-27-21-12-11-16(14-22(21)28-2)13-20(17-7-4-3-5-8-17)25-23(26)18-9-6-10-19(24)15-18/h3-5,7-8,11-12,14,18-20H,6,9-10,13,15,24H2,1-2H3,(H,25,26) |
| InChIKey | GZAYWYDXTVNAMJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |