C12H17IN2O3 — CID 119768618
N-[2-hydroxy-3-(4-iodophenoxy)propyl]-2-(methylamino)acetamide (PubChem CID 119768618) has the molecular formula C12H17IN2O3 and a molecular weight of 364.18 g/mol. Its IUPAC name is N-[2-hydroxy-3-(4-iodophenoxy)propyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-hydroxy-3-(4-iodophenoxy)propyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 119768618 |
| Molecular Formula | C12H17IN2O3 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-[2-hydroxy-3-(4-iodophenoxy)propyl]-2-(methylamino)acetamide |
| SMILES | CNCC(=O)NCC(O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C12H17IN2O3/c1-14-7-12(17)15-6-10(16)8-18-11-4-2-9(13)3-5-11/h2-5,10,14,16H,6-8H2,1H3,(H,15,17) |
| InChIKey | KSQXNPMJVSPNOY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|