C16H22ClFN2O2 — CID 119770443
1-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyrrolidin-2-ylethanone;hydrochloride (PubChem CID 119770443) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyrrolidin-2-ylethanone;hydrochloride.
| Compound Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyrrolidin-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119770443 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-2-pyrrolidin-2-ylethanone;hydrochloride |
| SMILES | Cl.O=C(CC1CCCN1)N1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C16H21FN2O2.ClH/c17-13-4-1-3-12(9-13)15-11-19(7-8-21-15)16(20)10-14-5-2-6-18-14;/h1,3-4,9,14-15,18H,2,5-8,10-11H2;1H |
| InChIKey | YYYRBGQFQCUALI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |