C14H19F2N3O2 — CID 119771989
N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-4-(methylamino)butanamide (PubChem CID 119771989) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-4-(methylamino)butanamide.
| Compound Name | N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119771989 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[2-(3,5-difluoroanilino)-2-oxoethyl]-N-methyl-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)N(C)CC(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H19F2N3O2/c1-17-5-3-4-14(21)19(2)9-13(20)18-12-7-10(15)6-11(16)8-12/h6-8,17H,3-5,9H2,1-2H3,(H,18,20) |
| InChIKey | BDDDMBBUOMVYAW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|