C13H16F3N3O4S — CID 119775820
N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]morpholine-2-carboxamide (PubChem CID 119775820) has the molecular formula C13H16F3N3O4S and a molecular weight of 367.35 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]morpholine-2-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119775820 |
| Molecular Formula | C13H16F3N3O4S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[2-(methanesulfonamido)-5-(trifluoromethyl)phenyl]morpholine-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(F)(F)F)cc1NC(=O)C1CNCCO1 |
| InChI | InChI=1S/C13H16F3N3O4S/c1-24(21,22)19-9-3-2-8(13(14,15)16)6-10(9)18-12(20)11-7-17-4-5-23-11/h2-3,6,11,17,19H,4-5,7H2,1H3,(H,18,20) |
| InChIKey | XVFNIFYLQNVTEF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |