C13H19N3O4S — CID 119802655
N-[2-(methanesulfonamido)-5-methylphenyl]morpholine-2-carboxamide (PubChem CID 119802655) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)-5-methylphenyl]morpholine-2-carboxamide.
| Compound Name | N-[2-(methanesulfonamido)-5-methylphenyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119802655 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[2-(methanesulfonamido)-5-methylphenyl]morpholine-2-carboxamide |
| SMILES | Cc1ccc(NS(C)(=O)=O)c(NC(=O)C2CNCCO2)c1 |
| InChI | InChI=1S/C13H19N3O4S/c1-9-3-4-10(16-21(2,18)19)11(7-9)15-13(17)12-8-14-5-6-20-12/h3-4,7,12,14,16H,5-6,8H2,1-2H3,(H,15,17) |
| InChIKey | DAHIEHHMMOERBW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |