C17H23Cl2N3OS — CID 119778537
N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119778537) has the molecular formula C17H23Cl2N3OS and a molecular weight of 388.36 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119778537 |
| Molecular Formula | C17H23Cl2N3OS |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC(C)c1sc(-c2ccc(Cl)cc2)nc1C.Cl |
| InChI | InChI=1S/C17H22ClN3OS.ClH/c1-11(20-15(22)5-4-10-19-3)16-12(2)21-17(23-16)13-6-8-14(18)9-7-13;/h6-9,11,19H,4-5,10H2,1-3H3,(H,20,22);1H |
| InChIKey | YZVKMBUIBALOCC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|