C17H23Cl2N3O2S — CID 119778561
N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119778561) has the molecular formula C17H23Cl2N3O2S and a molecular weight of 404.36 g/mol. Its IUPAC name is N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119778561 |
| Molecular Formula | C17H23Cl2N3O2S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC(C)c1sc(-c2ccc(Cl)cc2)nc1C.Cl |
| InChI | InChI=1S/C17H22ClN3O2S.ClH/c1-11(20-15(22)10-19-8-9-23-3)16-12(2)21-17(24-16)13-4-6-14(18)7-5-13;/h4-7,11,19H,8-10H2,1-3H3,(H,20,22);1H |
| InChIKey | SMRHSYJBOHETRF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|