C17H20ClN3O3S — CID 122001200
4-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylcarbamoylamino]butanoic acid (PubChem CID 122001200) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 4-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122001200 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[1-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]ethylcarbamoylamino]butanoic acid |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1C(C)NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C17H20ClN3O3S/c1-10-15(11(2)21-17(24)19-9-3-4-14(22)23)25-16(20-10)12-5-7-13(18)8-6-12/h5-8,11H,3-4,9H2,1-2H3,(H,22,23)(H2,19,21,24) |
| InChIKey | GHJNRNDBORCVPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|