C20H29N3O5 — CID 119779928
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]morpholine-2-carboxamide (PubChem CID 119779928) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]morpholine-2-carboxamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119779928 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]morpholine-2-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CCCNC(=O)C1CNCCO1)CC2 |
| InChI | InChI=1S/C20H29N3O5/c1-26-16-10-14-5-8-23(13-15(14)11-17(16)27-2)19(24)4-3-6-22-20(25)18-12-21-7-9-28-18/h10-11,18,21H,3-9,12-13H2,1-2H3,(H,22,25) |
| InChIKey | MMMTZCWUNHFZOO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|