C13H18ClN5O2 — CID 119780393
2-(2-methoxyethylamino)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide;hydrochloride (PubChem CID 119780393) has the molecular formula C13H18ClN5O2 and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119780393 |
| Molecular Formula | C13H18ClN5O2 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[4-(1H-1,2,4-triazol-5-yl)phenyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)Nc1ccc(-c2ncn[nH]2)cc1.Cl |
| InChI | InChI=1S/C13H17N5O2.ClH/c1-20-7-6-14-8-12(19)17-11-4-2-10(3-5-11)13-15-9-16-18-13;/h2-5,9,14H,6-8H2,1H3,(H,17,19)(H,15,16,18);1H |
| InChIKey | GWHAOSIZWGNROP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|