C19H25FN6O2 — CID 119783271
N-[3-[(3-fluorobenzoyl)amino]propyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119783271) has the molecular formula C19H25FN6O2 and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-[(3-fluorobenzoyl)amino]propyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[3-[(3-fluorobenzoyl)amino]propyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119783271 |
| Molecular Formula | C19H25FN6O2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-[3-[(3-fluorobenzoyl)amino]propyl]-5-methyl-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCNC(=O)c2cccc(F)c2)nnn1C1CCNCC1 |
| InChI | InChI=1S/C19H25FN6O2/c1-13-17(24-25-26(13)16-6-10-21-11-7-16)19(28)23-9-3-8-22-18(27)14-4-2-5-15(20)12-14/h2,4-5,12,16,21H,3,6-11H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | OLDJDWWQPGWWDZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|