C14H20Cl2N2O2S — CID 119791871
(4-amino-5-chloro-2-methoxyphenyl)-(2,2-dimethylthiomorpholin-4-yl)methanone;hydrochloride (PubChem CID 119791871) has the molecular formula C14H20Cl2N2O2S and a molecular weight of 351.30 g/mol. Its IUPAC name is (4-amino-5-chloro-2-methoxyphenyl)-(2,2-dimethylthiomorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (4-amino-5-chloro-2-methoxyphenyl)-(2,2-dimethylthiomorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119791871 |
| Molecular Formula | C14H20Cl2N2O2S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (4-amino-5-chloro-2-methoxyphenyl)-(2,2-dimethylthiomorpholin-4-yl)methanone;hydrochloride |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)N1CCSC(C)(C)C1.Cl |
| InChI | InChI=1S/C14H19ClN2O2S.ClH/c1-14(2)8-17(4-5-20-14)13(18)9-6-10(15)11(16)7-12(9)19-3;/h6-7H,4-5,8,16H2,1-3H3;1H |
| InChIKey | VYLWBRSFDSZLBD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|