C21H32N2O — CID 119797627
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-butyl-N-(1-phenylethyl)acetamide (PubChem CID 119797627) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-butyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-butyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 119797627 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-butyl-N-(1-phenylethyl)acetamide |
| SMILES | CCCCN(C(=O)CC1CC2CCC(C1)N2)C(C)c1ccccc1 |
| InChI | InChI=1S/C21H32N2O/c1-3-4-12-23(16(2)18-8-6-5-7-9-18)21(24)15-17-13-19-10-11-20(14-17)22-19/h5-9,16-17,19-20,22H,3-4,10-15H2,1-2H3 |
| InChIKey | GAZIWTRCMUORHN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |